C14H22F8OSi2 — CID 156767836
methyl-[methyl-prop-2-enyl-(2,2,3,3-tetrafluoropropyl)silyl]oxy-prop-2-enyl-(2,2,3,3-tetrafluoropropyl)silane (PubChem CID 156767836) has the molecular formula C14H22F8OSi2 and a molecular weight of 414.49 g/mol. Its IUPAC name is methyl-[methyl-prop-2-enyl-(2,2,3,3-tetrafluoropropyl)silyl]oxy-prop-2-enyl-(2,2,3,3-tetrafluoropropyl)silane.
| Compound Name | methyl-[methyl-prop-2-enyl-(2,2,3,3-tetrafluoropropyl)silyl]oxy-prop-2-enyl-(2,2,3,3-tetrafluoropropyl)silane |
|---|---|
| PubChem CID | 156767836 |
| Molecular Formula | C14H22F8OSi2 |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | methyl-[methyl-prop-2-enyl-(2,2,3,3-tetrafluoropropyl)silyl]oxy-prop-2-enyl-(2,2,3,3-tetrafluoropropyl)silane |
| SMILES | C=CC[Si](C)(CC(F)(F)C(F)F)O[Si](C)(CC=C)CC(F)(F)C(F)F |
| InChI | InChI=1S/C14H22F8OSi2/c1-5-7-24(3,9-13(19,20)11(15)16)23-25(4,8-6-2)10-14(21,22)12(17)18/h5-6,11-12H,1-2,7-10H2,3-4H3 |
| InChIKey | WEZUSKPYJBYGTD-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|