C6H13F4NSi — CID 15681451
2,2,3,3-tetrafluoro-N-trimethylsilylpropan-1-amine (PubChem CID 15681451) has the molecular formula C6H13F4NSi and a molecular weight of 203.25 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-trimethylsilylpropan-1-amine.
| Compound Name | 2,2,3,3-tetrafluoro-N-trimethylsilylpropan-1-amine |
|---|---|
| PubChem CID | 15681451 |
| Molecular Formula | C6H13F4NSi |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-trimethylsilylpropan-1-amine |
| SMILES | C[Si](C)(C)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C6H13F4NSi/c1-12(2,3)11-4-6(9,10)5(7)8/h5,11H,4H2,1-3H3 |
| InChIKey | JLYLHBISHUPVEK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|