C9H16F4N2 — CID 103529557
1-methyl-N-(2,2,3,3-tetrafluoropropyl)piperidin-4-amine (PubChem CID 103529557) has the molecular formula C9H16F4N2 and a molecular weight of 228.23 g/mol. Its IUPAC name is 1-methyl-N-(2,2,3,3-tetrafluoropropyl)piperidin-4-amine.
| Compound Name | 1-methyl-N-(2,2,3,3-tetrafluoropropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 103529557 |
| Molecular Formula | C9H16F4N2 |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 1-methyl-N-(2,2,3,3-tetrafluoropropyl)piperidin-4-amine |
| SMILES | CN1CCC(NCC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C9H16F4N2/c1-15-4-2-7(3-5-15)14-6-9(12,13)8(10)11/h7-8,14H,2-6H2,1H3 |
| InChIKey | DIFOPUAMNWVPOK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|