C10H17F4N3O — CID 106291879
1-(4-methylpiperazin-1-yl)-2-(2,2,3,3-tetrafluoropropylamino)ethanone (PubChem CID 106291879) has the molecular formula C10H17F4N3O and a molecular weight of 271.26 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-2-(2,2,3,3-tetrafluoropropylamino)ethanone.
| Compound Name | 1-(4-methylpiperazin-1-yl)-2-(2,2,3,3-tetrafluoropropylamino)ethanone |
|---|---|
| PubChem CID | 106291879 |
| Molecular Formula | C10H17F4N3O |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-2-(2,2,3,3-tetrafluoropropylamino)ethanone |
| SMILES | CN1CCN(C(=O)CNCC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C10H17F4N3O/c1-16-2-4-17(5-3-16)8(18)6-15-7-10(13,14)9(11)12/h9,15H,2-7H2,1H3 |
| InChIKey | SLHRBWWVNYEMLI-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|