C10H14F7N — CID 104934178
N-(2,2,3,3-tetrafluoropropyl)-2-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 104934178) has the molecular formula C10H14F7N and a molecular weight of 281.22 g/mol. Its IUPAC name is N-(2,2,3,3-tetrafluoropropyl)-2-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-(2,2,3,3-tetrafluoropropyl)-2-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 104934178 |
| Molecular Formula | C10H14F7N |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-(2,2,3,3-tetrafluoropropyl)-2-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | FC(F)C(F)(F)CNC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C10H14F7N/c11-8(12)9(13,14)5-18-7-4-2-1-3-6(7)10(15,16)17/h6-8,18H,1-5H2 |
| InChIKey | ILHPFQUXXMRECC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|