C12H20F4N2 — CID 106289452
2-pyrrolidin-2-yl-N-(2,2,3,3-tetrafluoropropyl)cyclopentan-1-amine (PubChem CID 106289452) has the molecular formula C12H20F4N2 and a molecular weight of 268.30 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-N-(2,2,3,3-tetrafluoropropyl)cyclopentan-1-amine.
| Compound Name | 2-pyrrolidin-2-yl-N-(2,2,3,3-tetrafluoropropyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 106289452 |
| Molecular Formula | C12H20F4N2 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-pyrrolidin-2-yl-N-(2,2,3,3-tetrafluoropropyl)cyclopentan-1-amine |
| SMILES | FC(F)C(F)(F)CNC1CCCC1C1CCCN1 |
| InChI | InChI=1S/C12H20F4N2/c13-11(14)12(15,16)7-18-10-4-1-3-8(10)9-5-2-6-17-9/h8-11,17-18H,1-7H2 |
| InChIKey | JSAMOXRQCSWXFQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|