C13H27N3 — CID 79543435
N'-(2-pyrrolidin-2-ylcyclopentyl)butane-1,4-diamine (PubChem CID 79543435) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is N'-(2-pyrrolidin-2-ylcyclopentyl)butane-1,4-diamine.
| Compound Name | N'-(2-pyrrolidin-2-ylcyclopentyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 79543435 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | N'-(2-pyrrolidin-2-ylcyclopentyl)butane-1,4-diamine |
| SMILES | NCCCCNC1CCCC1C1CCCN1 |
| InChI | InChI=1S/C13H27N3/c14-8-1-2-9-15-12-6-3-5-11(12)13-7-4-10-16-13/h11-13,15-16H,1-10,14H2 |
| InChIKey | PDAYEMWPYQATKZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|