C13H21F4N — CID 114169083
1,3,3-trimethyl-N-(2,2,3,3-tetrafluoropropyl)bicyclo[2.2.1]heptan-2-amine (PubChem CID 114169083) has the molecular formula C13H21F4N and a molecular weight of 267.31 g/mol. Its IUPAC name is 1,3,3-trimethyl-N-(2,2,3,3-tetrafluoropropyl)bicyclo[2.2.1]heptan-2-amine.
| Compound Name | 1,3,3-trimethyl-N-(2,2,3,3-tetrafluoropropyl)bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 114169083 |
| Molecular Formula | C13H21F4N |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1,3,3-trimethyl-N-(2,2,3,3-tetrafluoropropyl)bicyclo[2.2.1]heptan-2-amine |
| SMILES | CC12CCC(C1)C(C)(C)C2NCC(F)(F)C(F)F |
| InChI | InChI=1S/C13H21F4N/c1-11(2)8-4-5-12(3,6-8)9(11)18-7-13(16,17)10(14)15/h8-10,18H,4-7H2,1-3H3 |
| InChIKey | KKHILZVRIAOMIF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|