C38H37NO2Si2 — CID 134949039
1-[2-(methoxy-naphthalen-1-yl-triphenylsilyloxysilyl)phenyl]-N,N-dimethylmethanamine (PubChem CID 134949039) has the molecular formula C38H37NO2Si2 and a molecular weight of 595.89 g/mol. Its IUPAC name is 1-[2-(methoxy-naphthalen-1-yl-triphenylsilyloxysilyl)phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-(methoxy-naphthalen-1-yl-triphenylsilyloxysilyl)phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 134949039 |
| Molecular Formula | C38H37NO2Si2 |
| Molecular Weight | 595.89 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | 1-[2-(methoxy-naphthalen-1-yl-triphenylsilyloxysilyl)phenyl]-N,N-dimethylmethanamine |
| SMILES | CO[Si](O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1CN(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C38H37NO2Si2/c1-39(2)30-32-19-14-16-28-37(32)43(40-3,38-29-17-20-31-18-13-15-27-36(31)38)41-42(33-21-7-4-8-22-33,34-23-9-5-10-24-34)35-25-11-6-12-26-35/h4-29H,30H2,1-3H3 |
| InChIKey | QYWFMFXTHWHCOG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.89 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|