C38H40O2Si3 — CID 102005003
bis[2-(hydroxy-naphthalen-1-yl-phenylsilyl)ethyl]-dimethylsilane (PubChem CID 102005003) has the molecular formula C38H40O2Si3 and a molecular weight of 612.99 g/mol. Its IUPAC name is bis[2-(hydroxy-naphthalen-1-yl-phenylsilyl)ethyl]-dimethylsilane.
| Compound Name | bis[2-(hydroxy-naphthalen-1-yl-phenylsilyl)ethyl]-dimethylsilane |
|---|---|
| PubChem CID | 102005003 |
| Molecular Formula | C38H40O2Si3 |
| Molecular Weight | 612.99 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | bis[2-(hydroxy-naphthalen-1-yl-phenylsilyl)ethyl]-dimethylsilane |
| SMILES | C[Si](C)(CC[Si](O)(c1ccccc1)c1cccc2ccccc12)CC[Si](O)(c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C38H40O2Si3/c1-41(2,27-29-42(39,33-19-5-3-6-20-33)37-25-13-17-31-15-9-11-23-35(31)37)28-30-43(40,34-21-7-4-8-22-34)38-26-14-18-32-16-10-12-24-36(32)38/h3-26,39-40H,27-30H2,1-2H3 |
| InChIKey | VQUWVXCHBBBLFK-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.99 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|