C33H33NSi — CID 100943831
(1R)-N-(methyl-naphthalen-1-yl-phenylsilyl)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine (PubChem CID 100943831) has the molecular formula C33H33NSi and a molecular weight of 471.72 g/mol. Its IUPAC name is (1R)-N-(methyl-naphthalen-1-yl-phenylsilyl)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine.
| Compound Name | (1R)-N-(methyl-naphthalen-1-yl-phenylsilyl)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine |
|---|---|
| PubChem CID | 100943831 |
| Molecular Formula | C33H33NSi |
| Molecular Weight | 471.72 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | (1R)-N-(methyl-naphthalen-1-yl-phenylsilyl)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine |
| SMILES | C[C@H](c1ccccc1)N([C@H](C)c1ccccc1)[Si@@](C)(c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C33H33NSi/c1-26(28-16-7-4-8-17-28)34(27(2)29-18-9-5-10-19-29)35(3,31-22-11-6-12-23-31)33-25-15-21-30-20-13-14-24-32(30)33/h4-27H,1-3H3/t26-,27-,35+/m1/s1 |
| InChIKey | OMIJTGLRDWXPBJ-NVOANOBXSA-N |
| XLogP | 7.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.72 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|