C36H31CuNO2P+2 — CID 134946185
N,N-bis[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine;copper(1+) (PubChem CID 134946185) has the molecular formula C36H31CuNO2P+2 and a molecular weight of 604.17 g/mol. Its IUPAC name is N,N-bis[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine;copper(1+).
| Compound Name | N,N-bis[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine;copper(1+) |
|---|---|
| PubChem CID | 134946185 |
| Molecular Formula | C36H31CuNO2P+2 |
| Molecular Weight | 604.17 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | N,N-bis[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine;copper(1+) |
| SMILES | C[C@@H](c1ccccc1)N([C@@H](C)c1ccccc1)[PH+]1Oc2ccc3ccccc3c2-c2c(ccc3ccccc23)O1.[Cu+] |
| InChI | InChI=1S/C36H30NO2P.Cu/c1-25(27-13-5-3-6-14-27)37(26(2)28-15-7-4-8-16-28)40-38-33-23-21-29-17-9-11-19-31(29)35(33)36-32-20-12-10-18-30(32)22-24-34(36)39-40;/h3-26H,1-2H3;/q;+1/p+1/t25-,26-;/m0./s1 |
| InChIKey | GWPJCVGGRMWYSF-CCQIZPNASA-O |
| XLogP | 10.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.17 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|