C48H39AuClNO2P+ — CID 164666242
chlorogold;3,23-diphenyl-N,N-bis[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.05,10.016,21]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine (PubChem CID 164666242) has the molecular formula C48H39AuClNO2P+ and a molecular weight of 925.24 g/mol. Its IUPAC name is chlorogold;3,23-diphenyl-N,N-bis[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.05,10.016,21]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine.
| Compound Name | chlorogold;3,23-diphenyl-N,N-bis[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.05,10.016,21]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine |
|---|---|
| PubChem CID | 164666242 |
| Molecular Formula | C48H39AuClNO2P+ |
| Molecular Weight | 925.24 g/mol |
| Exact Mass | 924.21 |
| IUPAC Name | chlorogold;3,23-diphenyl-N,N-bis[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.05,10.016,21]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine |
| SMILES | C[C@@H](c1ccccc1)N([C@@H](C)c1ccccc1)[PH+]1Oc2c(c(-c3ccccc3)cc3ccccc23)-c2c(-c3ccccc3)cc3ccccc3c2O1.Cl[Au] |
| InChI | InChI=1S/C48H38NO2P.Au.ClH/c1-33(35-19-7-3-8-20-35)49(34(2)36-21-9-4-10-22-36)52-50-47-41-29-17-15-27-39(41)31-43(37-23-11-5-12-24-37)45(47)46-44(38-25-13-6-14-26-38)32-40-28-16-18-30-42(40)48(46)51-52;;/h3-34H,1-2H3;;1H/q;+1;/t33-,34-;;/m0../s1 |
| InChIKey | CFSYBWJBUAFEBD-QNMHLEHBSA-N |
| XLogP | 14.24 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.24 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|