C39H40Si3 — CID 12030742
dimethyl-[methyl-[2-[[methyl(diphenyl)silyl]methyl]phenyl]-naphthalen-1-ylsilyl]-phenylsilane (PubChem CID 12030742) has the molecular formula C39H40Si3 and a molecular weight of 593.01 g/mol. Its IUPAC name is dimethyl-[methyl-[2-[[methyl(diphenyl)silyl]methyl]phenyl]-naphthalen-1-ylsilyl]-phenylsilane.
| Compound Name | dimethyl-[methyl-[2-[[methyl(diphenyl)silyl]methyl]phenyl]-naphthalen-1-ylsilyl]-phenylsilane |
|---|---|
| PubChem CID | 12030742 |
| Molecular Formula | C39H40Si3 |
| Molecular Weight | 593.01 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | dimethyl-[methyl-[2-[[methyl(diphenyl)silyl]methyl]phenyl]-naphthalen-1-ylsilyl]-phenylsilane |
| SMILES | C[Si](Cc1ccccc1[Si](C)(c1cccc2ccccc12)[Si](C)(C)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H40Si3/c1-40(2,34-22-8-5-9-23-34)42(4,39-30-18-21-32-19-14-16-28-37(32)39)38-29-17-15-20-33(38)31-41(3,35-24-10-6-11-25-35)36-26-12-7-13-27-36/h5-30H,31H2,1-4H3 |
| InChIKey | CKHCJBWFXHSNPW-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.01 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|