C20H30Cl2N2Si2 — CID 12987217
1-[2-[chloro-[chloro(dimethyl)silyl]-[2-[(dimethylamino)methyl]phenyl]silyl]phenyl]-N,N-dimethylmethanamine (PubChem CID 12987217) has the molecular formula C20H30Cl2N2Si2 and a molecular weight of 425.55 g/mol. Its IUPAC name is 1-[2-[chloro-[chloro(dimethyl)silyl]-[2-[(dimethylamino)methyl]phenyl]silyl]phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-[chloro-[chloro(dimethyl)silyl]-[2-[(dimethylamino)methyl]phenyl]silyl]phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 12987217 |
| Molecular Formula | C20H30Cl2N2Si2 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 1-[2-[chloro-[chloro(dimethyl)silyl]-[2-[(dimethylamino)methyl]phenyl]silyl]phenyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ccccc1[Si](Cl)(c1ccccc1CN(C)C)[Si](C)(C)Cl |
| InChI | InChI=1S/C20H30Cl2N2Si2/c1-23(2)15-17-11-7-9-13-19(17)26(22,25(5,6)21)20-14-10-8-12-18(20)16-24(3)4/h7-14H,15-16H2,1-6H3 |
| InChIKey | KFVJWLULKJMHND-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|