C14H24N2Si — CID 101261920
1-[2-(dimethylamino-ethenyl-methylsilyl)phenyl]-N,N-dimethylmethanamine (PubChem CID 101261920) has the molecular formula C14H24N2Si and a molecular weight of 248.45 g/mol. Its IUPAC name is 1-[2-(dimethylamino-ethenyl-methylsilyl)phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-(dimethylamino-ethenyl-methylsilyl)phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 101261920 |
| Molecular Formula | C14H24N2Si |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 1-[2-(dimethylamino-ethenyl-methylsilyl)phenyl]-N,N-dimethylmethanamine |
| SMILES | C=C[Si](C)(c1ccccc1CN(C)C)N(C)C |
| InChI | InChI=1S/C14H24N2Si/c1-7-17(6,16(4)5)14-11-9-8-10-13(14)12-15(2)3/h7-11H,1,12H2,2-6H3 |
| InChIKey | IWARNUPRBSADFM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|