About CID 138974220
CID 138974220 (PubChem CID 138974220) has the molecular formula C27H36Bi3N3
and a molecular weight of 1029.55 g/mol.
Molecular Properties
| Compound Name | CID 138974220 |
| PubChem CID | 138974220 |
| Molecular Formula | C27H36Bi3N3 |
| Molecular Weight | 1029.55 g/mol |
| Exact Mass | 1029.23 |
| IUPAC Name | — |
| SMILES | CN(C)Cc1ccccc1[Bi].CN(C)Cc1ccccc1[Bi].CN(C)Cc1ccccc1[Bi] |
| InChI | InChI=1S/3C9H12N.3Bi/c3*1-10(2)8-9-6-4-3-5-7-9;;;/h3*3-6H,8H2,1-2H3;;; |
| InChIKey | NEUPDUGBNNIVTE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 1029.55 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 138974220 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 138974220?
The IUPAC name of CID 138974220 (CID 138974220) is not available.
What is the SMILES notation for CID 138974220?
The canonical SMILES for CID 138974220 is CN(C)Cc1ccccc1[Bi].CN(C)Cc1ccccc1[Bi].CN(C)Cc1ccccc1[Bi].
What is the InChIKey of CID 138974220?
The InChIKey is NEUPDUGBNNIVTE-UHFFFAOYSA-N. The full InChI is InChI=1S/3C9H12N.3Bi/c3*1-10(2)8-9-6-4-3-5-7-9;;;/h3*3-6H,8H2,1-2H3;;;.
What are the key properties of CID 138974220?
CID 138974220 has a molecular weight of 1029.55 g/mol, XLogP of 1.63, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 138974220 is sourced from PubChem (CID 138974220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).