C23H42ClN — CID 175358884
N,N-dimethyl-1-(2-tetradecylphenyl)methanamine;hydrochloride (PubChem CID 175358884) has the molecular formula C23H42ClN and a molecular weight of 368.05 g/mol. Its IUPAC name is N,N-dimethyl-1-(2-tetradecylphenyl)methanamine;hydrochloride.
| Compound Name | N,N-dimethyl-1-(2-tetradecylphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 175358884 |
| Molecular Formula | C23H42ClN |
| Molecular Weight | 368.05 g/mol |
| Exact Mass | 367.30 |
| IUPAC Name | N,N-dimethyl-1-(2-tetradecylphenyl)methanamine;hydrochloride |
| SMILES | CCCCCCCCCCCCCCc1ccccc1CN(C)C.Cl |
| InChI | InChI=1S/C23H41N.ClH/c1-4-5-6-7-8-9-10-11-12-13-14-15-18-22-19-16-17-20-23(22)21-24(2)3;/h16-17,19-20H,4-15,18,21H2,1-3H3;1H |
| InChIKey | UMDNSVSFIQVCEY-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.05 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|