C21H38IN — CID 173329859
1-(2-dodecylphenyl)-N,N-dimethylmethanamine;hydroiodide (PubChem CID 173329859) has the molecular formula C21H38IN and a molecular weight of 431.45 g/mol. Its IUPAC name is 1-(2-dodecylphenyl)-N,N-dimethylmethanamine;hydroiodide.
| Compound Name | 1-(2-dodecylphenyl)-N,N-dimethylmethanamine;hydroiodide |
|---|---|
| PubChem CID | 173329859 |
| Molecular Formula | C21H38IN |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 1-(2-dodecylphenyl)-N,N-dimethylmethanamine;hydroiodide |
| SMILES | CCCCCCCCCCCCc1ccccc1CN(C)C.I |
| InChI | InChI=1S/C21H37N.HI/c1-4-5-6-7-8-9-10-11-12-13-16-20-17-14-15-18-21(20)19-22(2)3;/h14-15,17-18H,4-13,16,19H2,1-3H3;1H |
| InChIKey | CNDGBLVMUCNIIV-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|