About CID 12985165
CID 12985165 (PubChem CID 12985165) has the molecular formula C38H54N4Si3
and a molecular weight of 651.14 g/mol.
Molecular Properties
| Compound Name | CID 12985165 |
| PubChem CID | 12985165 |
| Molecular Formula | C38H54N4Si3 |
| Molecular Weight | 651.14 g/mol |
| Exact Mass | 650.37 |
| IUPAC Name | — |
| SMILES | CN(C)Cc1ccccc1[Si](c1ccccc1CN(C)C)[Si](C)(C)[Si](c1ccccc1CN(C)C)c1ccccc1CN(C)C |
| InChI | InChI=1S/C38H54N4Si3/c1-39(2)27-31-19-11-15-23-35(31)43(36-24-16-12-20-32(36)28-40(3)4)45(9,10)44(37-25-17-13-21-33(37)29-41(5)6)38-26-18-14-22-34(38)30-42(7)8/h11-26H,27-30H2,1-10H3 |
| InChIKey | QLCNVOYAXJZTLI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 651.14 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 12985165 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12985165?
The IUPAC name of CID 12985165 (CID 12985165) is not available.
What is the SMILES notation for CID 12985165?
The canonical SMILES for CID 12985165 is CN(C)Cc1ccccc1[Si](c1ccccc1CN(C)C)[Si](C)(C)[Si](c1ccccc1CN(C)C)c1ccccc1CN(C)C.
What is the InChIKey of CID 12985165?
The InChIKey is QLCNVOYAXJZTLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H54N4Si3/c1-39(2)27-31-19-11-15-23-35(31)43(36-24-16-12-20-32(36)28-40(3)4)45(9,10)44(37-25-17-13-21-33(37)29-41(5)6)38-26-18-14-22-34(38)30-42(7)8/h11-26H,27-30H2,1-10H3.
What are the key properties of CID 12985165?
CID 12985165 has a molecular weight of 651.14 g/mol, XLogP of 3.72, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12985165 is sourced from PubChem (CID 12985165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).