C13H22GaN — CID 88509359
1-(2-diethylgallanylphenyl)-N,N-dimethylmethanamine (PubChem CID 88509359) has the molecular formula C13H22GaN and a molecular weight of 262.05 g/mol. Its IUPAC name is 1-(2-diethylgallanylphenyl)-N,N-dimethylmethanamine.
| Compound Name | 1-(2-diethylgallanylphenyl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 88509359 |
| Molecular Formula | C13H22GaN |
| Molecular Weight | 262.05 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1-(2-diethylgallanylphenyl)-N,N-dimethylmethanamine |
| SMILES | CC[Ga](CC)c1ccccc1CN(C)C |
| InChI | InChI=1S/C9H12N.2C2H5.Ga/c1-10(2)8-9-6-4-3-5-7-9;2*1-2;/h3-6H,8H2,1-2H3;2*1H2,2H3; |
| InChIKey | KWAZZPIYCUKYGR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.05 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |