C25H43N2PSi2 — CID 15436117
1-[2-[bis(trimethylsilyl)methyl-[2-[(dimethylamino)methyl]phenyl]phosphanyl]phenyl]-N,N-dimethylmethanamine (PubChem CID 15436117) has the molecular formula C25H43N2PSi2 and a molecular weight of 458.78 g/mol. Its IUPAC name is 1-[2-[bis(trimethylsilyl)methyl-[2-[(dimethylamino)methyl]phenyl]phosphanyl]phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-[bis(trimethylsilyl)methyl-[2-[(dimethylamino)methyl]phenyl]phosphanyl]phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 15436117 |
| Molecular Formula | C25H43N2PSi2 |
| Molecular Weight | 458.78 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 1-[2-[bis(trimethylsilyl)methyl-[2-[(dimethylamino)methyl]phenyl]phosphanyl]phenyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ccccc1P(c1ccccc1CN(C)C)C([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C25H43N2PSi2/c1-26(2)19-21-15-11-13-17-23(21)28(25(29(5,6)7)30(8,9)10)24-18-14-12-16-22(24)20-27(3)4/h11-18,25H,19-20H2,1-10H3 |
| InChIKey | BSKRQYMFXDAKLE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.78 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|