C16H20NP — CID 15446809
N,N-dimethyl-1-[2-[methyl(phenyl)phosphanyl]phenyl]methanamine (PubChem CID 15446809) has the molecular formula C16H20NP and a molecular weight of 257.32 g/mol. Its IUPAC name is N,N-dimethyl-1-[2-[methyl(phenyl)phosphanyl]phenyl]methanamine.
| Compound Name | N,N-dimethyl-1-[2-[methyl(phenyl)phosphanyl]phenyl]methanamine |
|---|---|
| PubChem CID | 15446809 |
| Molecular Formula | C16H20NP |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N,N-dimethyl-1-[2-[methyl(phenyl)phosphanyl]phenyl]methanamine |
| SMILES | CN(C)Cc1ccccc1P(C)c1ccccc1 |
| InChI | InChI=1S/C16H20NP/c1-17(2)13-14-9-7-8-12-16(14)18(3)15-10-5-4-6-11-15/h4-12H,13H2,1-3H3 |
| InChIKey | MKTODXCDBNLKOO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|