C21H29P — CID 90110911
(2,3-dibutylphenyl)-methyl-phenylphosphane (PubChem CID 90110911) has the molecular formula C21H29P and a molecular weight of 312.44 g/mol. Its IUPAC name is (2,3-dibutylphenyl)-methyl-phenylphosphane.
| Compound Name | (2,3-dibutylphenyl)-methyl-phenylphosphane |
|---|---|
| PubChem CID | 90110911 |
| Molecular Formula | C21H29P |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (2,3-dibutylphenyl)-methyl-phenylphosphane |
| SMILES | CCCCc1cccc(P(C)c2ccccc2)c1CCCC |
| InChI | InChI=1S/C21H29P/c1-4-6-12-18-13-11-17-21(20(18)16-7-5-2)22(3)19-14-9-8-10-15-19/h8-11,13-15,17H,4-7,12,16H2,1-3H3 |
| InChIKey | HYJJOVYUWXKFKO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|