[2,3-di(nonyl)phenyl]phosphonous acid

C24H43O2P — CID 19736789

IUPAC[2,3-di(nonyl)phenyl]phosphonous acid
SMILESCCCCCCCCCc1cccc(P(O)O)c1CCCCCCCCC
InChIInChI=1S/C24H43O2P/c1-3-5-7-9-11-13-15-18-22-19-17-21-24(27(25)26)23(22)20-16-14-12-10-8-6-4-2/h17,19,21,25-26H,3-16,18,20H2,1-2H3
InChIKeyYTCJVTWDPZDVDI-UHFFFAOYSA-N
MW394.58 g/mol
LogP7.19
Rot. Bonds17

About [2,3-di(nonyl)phenyl]phosphonous acid

[2,3-di(nonyl)phenyl]phosphonous acid (PubChem CID 19736789) has the molecular formula C24H43O2P and a molecular weight of 394.58 g/mol. Its IUPAC name is [2,3-di(nonyl)phenyl]phosphonous acid.

Molecular Properties

Compound Name[2,3-di(nonyl)phenyl]phosphonous acid
PubChem CID19736789
Molecular FormulaC24H43O2P
Molecular Weight394.58 g/mol
Exact Mass394.30
IUPAC Name[2,3-di(nonyl)phenyl]phosphonous acid
SMILESCCCCCCCCCc1cccc(P(O)O)c1CCCCCCCCC
InChIInChI=1S/C24H43O2P/c1-3-5-7-9-11-13-15-18-22-19-17-21-24(27(25)26)23(22)20-16-14-12-10-8-6-4-2/h17,19,21,25-26H,3-16,18,20H2,1-2H3
InChIKeyYTCJVTWDPZDVDI-UHFFFAOYSA-N
XLogP7.19
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds17
Heavy Atoms27
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500394.58
LogP ≤ 57.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [2,3-di(nonyl)phenyl]phosphonous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,3-di(nonyl)phenyl]phosphonous acid?
The IUPAC name of [2,3-di(nonyl)phenyl]phosphonous acid (CID 19736789) is [2,3-di(nonyl)phenyl]phosphonous acid.
What is the SMILES notation for [2,3-di(nonyl)phenyl]phosphonous acid?
The canonical SMILES for [2,3-di(nonyl)phenyl]phosphonous acid is CCCCCCCCCc1cccc(P(O)O)c1CCCCCCCCC.
What is the InChIKey of [2,3-di(nonyl)phenyl]phosphonous acid?
The InChIKey is YTCJVTWDPZDVDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H43O2P/c1-3-5-7-9-11-13-15-18-22-19-17-21-24(27(25)26)23(22)20-16-14-12-10-8-6-4-2/h17,19,21,25-26H,3-16,18,20H2,1-2H3.
What are the key properties of [2,3-di(nonyl)phenyl]phosphonous acid?
[2,3-di(nonyl)phenyl]phosphonous acid has a molecular weight of 394.58 g/mol, XLogP of 7.19, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-di(nonyl)phenyl]phosphonous acid is sourced from PubChem (CID 19736789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).