C16H31NSbSi2 — CID 177427837
CID 177427837 (PubChem CID 177427837) has the molecular formula C16H31NSbSi2 and a molecular weight of 415.36 g/mol.
| Compound Name | CID 177427837 |
|---|---|
| PubChem CID | 177427837 |
| Molecular Formula | C16H31NSbSi2 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | — |
| SMILES | CN(C)Cc1ccccc1[Sb]C([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C9H12N.C7H19Si2.Sb/c1-10(2)8-9-6-4-3-5-7-9;1-8(2,3)7-9(4,5)6;/h3-6H,8H2,1-2H3;7H,1-6H3; |
| InChIKey | LSKWCQFMOABZRT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|