C24H40NOPSi2 — CID 102300991
1-[2-[bis(trimethylsilyl)methyl-[2-(methoxymethyl)phenyl]phosphanyl]phenyl]-N,N-dimethylmethanamine (PubChem CID 102300991) has the molecular formula C24H40NOPSi2 and a molecular weight of 445.74 g/mol. Its IUPAC name is 1-[2-[bis(trimethylsilyl)methyl-[2-(methoxymethyl)phenyl]phosphanyl]phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-[bis(trimethylsilyl)methyl-[2-(methoxymethyl)phenyl]phosphanyl]phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 102300991 |
| Molecular Formula | C24H40NOPSi2 |
| Molecular Weight | 445.74 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 1-[2-[bis(trimethylsilyl)methyl-[2-(methoxymethyl)phenyl]phosphanyl]phenyl]-N,N-dimethylmethanamine |
| SMILES | COCc1ccccc1P(c1ccccc1CN(C)C)C([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C24H40NOPSi2/c1-25(2)18-20-14-10-12-16-22(20)27(24(28(4,5)6)29(7,8)9)23-17-13-11-15-21(23)19-26-3/h10-17,24H,18-19H2,1-9H3 |
| InChIKey | MVZWHXFKGFJCMH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.74 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|