About ethenyl(silyloxysilyloxy)silane;trimethoxy(phenyl)silane
ethenyl(silyloxysilyloxy)silane;trimethoxy(phenyl)silane (PubChem CID 175494347) has the molecular formula C11H24O5Si4
and a molecular weight of 348.65 g/mol. Its IUPAC name is ethenyl(silyloxysilyloxy)silane;trimethoxy(phenyl)silane.
Molecular Properties
| Compound Name | ethenyl(silyloxysilyloxy)silane;trimethoxy(phenyl)silane |
| PubChem CID | 175494347 |
| Molecular Formula | C11H24O5Si4 |
| Molecular Weight | 348.65 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | ethenyl(silyloxysilyloxy)silane;trimethoxy(phenyl)silane |
| SMILES | C=C[SiH2]O[SiH2]O[SiH3].CO[Si](OC)(OC)c1ccccc1 |
| InChI | InChI=1S/C9H14O3Si.C2H10O2Si3/c1-10-13(11-2,12-3)9-7-5-4-6-8-9;1-2-6-4-7-3-5/h4-8H,1-3H3;2H,1,6-7H2,5H3 |
| InChIKey | FCHJTNUURCSFEA-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.65 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl(silyloxysilyloxy)silane;trimethoxy(phenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl(silyloxysilyloxy)silane;trimethoxy(phenyl)silane?
The IUPAC name of ethenyl(silyloxysilyloxy)silane;trimethoxy(phenyl)silane (CID 175494347) is ethenyl(silyloxysilyloxy)silane;trimethoxy(phenyl)silane.
What is the SMILES notation for ethenyl(silyloxysilyloxy)silane;trimethoxy(phenyl)silane?
The canonical SMILES for ethenyl(silyloxysilyloxy)silane;trimethoxy(phenyl)silane is C=C[SiH2]O[SiH2]O[SiH3].CO[Si](OC)(OC)c1ccccc1.
What is the InChIKey of ethenyl(silyloxysilyloxy)silane;trimethoxy(phenyl)silane?
The InChIKey is FCHJTNUURCSFEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3Si.C2H10O2Si3/c1-10-13(11-2,12-3)9-7-5-4-6-8-9;1-2-6-4-7-3-5/h4-8H,1-3H3;2H,1,6-7H2,5H3.
What are the key properties of ethenyl(silyloxysilyloxy)silane;trimethoxy(phenyl)silane?
ethenyl(silyloxysilyloxy)silane;trimethoxy(phenyl)silane has a molecular weight of 348.65 g/mol, XLogP of -1.70, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl(silyloxysilyloxy)silane;trimethoxy(phenyl)silane is sourced from PubChem (CID 175494347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).