C18H28O6Si3 — CID 171467146
[[[dimethoxy(methyl)silyl]oxy-diphenylsilyl]oxy-methoxy-methylsilyl]methanol (PubChem CID 171467146) has the molecular formula C18H28O6Si3 and a molecular weight of 424.67 g/mol. Its IUPAC name is [[[dimethoxy(methyl)silyl]oxy-diphenylsilyl]oxy-methoxy-methylsilyl]methanol.
| Compound Name | [[[dimethoxy(methyl)silyl]oxy-diphenylsilyl]oxy-methoxy-methylsilyl]methanol |
|---|---|
| PubChem CID | 171467146 |
| Molecular Formula | C18H28O6Si3 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | [[[dimethoxy(methyl)silyl]oxy-diphenylsilyl]oxy-methoxy-methylsilyl]methanol |
| SMILES | CO[Si](C)(CO)O[Si](O[Si](C)(OC)OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H28O6Si3/c1-20-25(4,16-19)23-27(17-12-8-6-9-13-17,18-14-10-7-11-15-18)24-26(5,21-2)22-3/h6-15,19H,16H2,1-5H3 |
| InChIKey | MWOALUDNFOQITE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|