C42H36O2Si3 — CID 154117908
diphenylsilyloxy-diphenyl-triphenylsilyloxysilane (PubChem CID 154117908) has the molecular formula C42H36O2Si3 and a molecular weight of 657.01 g/mol. Its IUPAC name is diphenylsilyloxy-diphenyl-triphenylsilyloxysilane.
| Compound Name | diphenylsilyloxy-diphenyl-triphenylsilyloxysilane |
|---|---|
| PubChem CID | 154117908 |
| Molecular Formula | C42H36O2Si3 |
| Molecular Weight | 657.01 g/mol |
| Exact Mass | 656.20 |
| IUPAC Name | diphenylsilyloxy-diphenyl-triphenylsilyloxysilane |
| SMILES | c1ccc([SiH](O[Si](O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H36O2Si3/c1-8-22-36(23-9-1)45(37-24-10-2-11-25-37)43-47(41-32-18-6-19-33-41,42-34-20-7-21-35-42)44-46(38-26-12-3-13-27-38,39-28-14-4-15-29-39)40-30-16-5-17-31-40/h1-35,45H |
| InChIKey | RRKCGSZWYLLDRP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.01 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|