C22H34O3Si2 — CID 162694863
(2-methoxyphenyl)methyl-[3-(2-methoxyphenyl)propyl-dimethylsilyl]oxy-dimethylsilane (PubChem CID 162694863) has the molecular formula C22H34O3Si2 and a molecular weight of 402.68 g/mol. Its IUPAC name is (2-methoxyphenyl)methyl-[3-(2-methoxyphenyl)propyl-dimethylsilyl]oxy-dimethylsilane.
| Compound Name | (2-methoxyphenyl)methyl-[3-(2-methoxyphenyl)propyl-dimethylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 162694863 |
| Molecular Formula | C22H34O3Si2 |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (2-methoxyphenyl)methyl-[3-(2-methoxyphenyl)propyl-dimethylsilyl]oxy-dimethylsilane |
| SMILES | COc1ccccc1CCC[Si](C)(C)O[Si](C)(C)Cc1ccccc1OC |
| InChI | InChI=1S/C22H34O3Si2/c1-23-21-15-9-7-12-19(21)14-11-17-26(3,4)25-27(5,6)18-20-13-8-10-16-22(20)24-2/h7-10,12-13,15-16H,11,14,17-18H2,1-6H3 |
| InChIKey | KVNRYYYGGSPCSZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|