C34H46O5Si2 — CID 123813906
[2-[3-[ethyl-[ethyl-[3-(2-methoxyphenyl)propyl]-methylsilyl]oxy-methylsilyl]propyl]phenyl] 3-acetylbenzoate (PubChem CID 123813906) has the molecular formula C34H46O5Si2 and a molecular weight of 590.91 g/mol. Its IUPAC name is [2-[3-[ethyl-[ethyl-[3-(2-methoxyphenyl)propyl]-methylsilyl]oxy-methylsilyl]propyl]phenyl] 3-acetylbenzoate.
| Compound Name | [2-[3-[ethyl-[ethyl-[3-(2-methoxyphenyl)propyl]-methylsilyl]oxy-methylsilyl]propyl]phenyl] 3-acetylbenzoate |
|---|---|
| PubChem CID | 123813906 |
| Molecular Formula | C34H46O5Si2 |
| Molecular Weight | 590.91 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | [2-[3-[ethyl-[ethyl-[3-(2-methoxyphenyl)propyl]-methylsilyl]oxy-methylsilyl]propyl]phenyl] 3-acetylbenzoate |
| SMILES | CC[Si](C)(CCCc1ccccc1OC)O[Si](C)(CC)CCCc1ccccc1OC(=O)c1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C34H46O5Si2/c1-7-40(5,24-14-20-28-16-9-11-22-32(28)37-4)39-41(6,8-2)25-15-21-29-17-10-12-23-33(29)38-34(36)31-19-13-18-30(26-31)27(3)35/h9-13,16-19,22-23,26H,7-8,14-15,20-21,24-25H2,1-6H3 |
| InChIKey | HVDUQQQKVURIQR-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.91 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|