About [2-(3-oxobutyl)phenyl] benzoate
[2-(3-oxobutyl)phenyl] benzoate (PubChem CID 143135304) has the molecular formula C17H16O3
and a molecular weight of 268.31 g/mol. Its IUPAC name is [2-(3-oxobutyl)phenyl] benzoate.
Molecular Properties
| Compound Name | [2-(3-oxobutyl)phenyl] benzoate |
| PubChem CID | 143135304 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | [2-(3-oxobutyl)phenyl] benzoate |
| SMILES | CC(=O)CCc1ccccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16O3/c1-13(18)11-12-14-7-5-6-10-16(14)20-17(19)15-8-3-2-4-9-15/h2-10H,11-12H2,1H3 |
| InChIKey | NRVJDXLZDKHITI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(3-oxobutyl)phenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-oxobutyl)phenyl] benzoate?
The IUPAC name of [2-(3-oxobutyl)phenyl] benzoate (CID 143135304) is [2-(3-oxobutyl)phenyl] benzoate.
What is the SMILES notation for [2-(3-oxobutyl)phenyl] benzoate?
The canonical SMILES for [2-(3-oxobutyl)phenyl] benzoate is CC(=O)CCc1ccccc1OC(=O)c1ccccc1.
What is the InChIKey of [2-(3-oxobutyl)phenyl] benzoate?
The InChIKey is NRVJDXLZDKHITI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3/c1-13(18)11-12-14-7-5-6-10-16(14)20-17(19)15-8-3-2-4-9-15/h2-10H,11-12H2,1H3.
What are the key properties of [2-(3-oxobutyl)phenyl] benzoate?
[2-(3-oxobutyl)phenyl] benzoate has a molecular weight of 268.31 g/mol, XLogP of 3.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-oxobutyl)phenyl] benzoate is sourced from PubChem (CID 143135304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).