C60H76O4Si5 — CID 58856778
tetrakis[dimethyl(3-naphthalen-1-ylpropyl)silyl] silicate (PubChem CID 58856778) has the molecular formula C60H76O4Si5 and a molecular weight of 1001.69 g/mol. Its IUPAC name is tetrakis[dimethyl(3-naphthalen-1-ylpropyl)silyl] silicate.
| Compound Name | tetrakis[dimethyl(3-naphthalen-1-ylpropyl)silyl] silicate |
|---|---|
| PubChem CID | 58856778 |
| Molecular Formula | C60H76O4Si5 |
| Molecular Weight | 1001.69 g/mol |
| Exact Mass | 1000.46 |
| IUPAC Name | tetrakis[dimethyl(3-naphthalen-1-ylpropyl)silyl] silicate |
| SMILES | C[Si](C)(CCCc1cccc2ccccc12)O[Si](O[Si](C)(C)CCCc1cccc2ccccc12)(O[Si](C)(C)CCCc1cccc2ccccc12)O[Si](C)(C)CCCc1cccc2ccccc12 |
| InChI | InChI=1S/C60H76O4Si5/c1-65(2,45-21-37-53-33-17-29-49-25-9-13-41-57(49)53)61-69(62-66(3,4)46-22-38-54-34-18-30-50-26-10-14-42-58(50)54,63-67(5,6)47-23-39-55-35-19-31-51-27-11-15-43-59(51)55)64-68(7,8)48-24-40-56-36-20-32-52-28-12-16-44-60(52)56/h9-20,25-36,41-44H,21-24,37-40,45-48H2,1-8H3 |
| InChIKey | CTTAUEZOEUSYEW-UHFFFAOYSA-N |
| XLogP | 17.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.69 |
| LogP ≤ 5 | 17.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|