C13H24O2Si2 — CID 137329179
2-[3-[methyl(trimethylsilyloxy)silyl]propyl]phenol (PubChem CID 137329179) has the molecular formula C13H24O2Si2 and a molecular weight of 268.50 g/mol. Its IUPAC name is 2-[3-[methyl(trimethylsilyloxy)silyl]propyl]phenol.
| Compound Name | 2-[3-[methyl(trimethylsilyloxy)silyl]propyl]phenol |
|---|---|
| PubChem CID | 137329179 |
| Molecular Formula | C13H24O2Si2 |
| Molecular Weight | 268.50 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-[3-[methyl(trimethylsilyloxy)silyl]propyl]phenol |
| SMILES | C[SiH](CCCc1ccccc1O)O[Si](C)(C)C |
| InChI | InChI=1S/C13H24O2Si2/c1-16(15-17(2,3)4)11-7-9-12-8-5-6-10-13(12)14/h5-6,8,10,14,16H,7,9,11H2,1-4H3 |
| InChIKey | PKRNHLQAPLWZBF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|