About 2-(3-iodopropyl)phenol
2-(3-iodopropyl)phenol (PubChem CID 72722847) has the molecular formula C9H11IO
and a molecular weight of 262.09 g/mol. Its IUPAC name is 2-(3-iodopropyl)phenol.
Molecular Properties
| Compound Name | 2-(3-iodopropyl)phenol |
| PubChem CID | 72722847 |
| Molecular Formula | C9H11IO |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 2-(3-iodopropyl)phenol |
| SMILES | Oc1ccccc1CCCI |
| InChI | InChI=1S/C9H11IO/c10-7-3-5-8-4-1-2-6-9(8)11/h1-2,4,6,11H,3,5,7H2 |
| InChIKey | QKUOOTZYWPQPQF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-iodopropyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-iodopropyl)phenol?
The IUPAC name of 2-(3-iodopropyl)phenol (CID 72722847) is 2-(3-iodopropyl)phenol.
What is the SMILES notation for 2-(3-iodopropyl)phenol?
The canonical SMILES for 2-(3-iodopropyl)phenol is Oc1ccccc1CCCI.
What is the InChIKey of 2-(3-iodopropyl)phenol?
The InChIKey is QKUOOTZYWPQPQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11IO/c10-7-3-5-8-4-1-2-6-9(8)11/h1-2,4,6,11H,3,5,7H2.
What are the key properties of 2-(3-iodopropyl)phenol?
2-(3-iodopropyl)phenol has a molecular weight of 262.09 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-iodopropyl)phenol is sourced from PubChem (CID 72722847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).