C18H34OSi2 — CID 20652808
(4-butan-2-ylphenyl)-[butyl(dimethyl)silyl]oxy-dimethylsilane (PubChem CID 20652808) has the molecular formula C18H34OSi2 and a molecular weight of 322.64 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)-[butyl(dimethyl)silyl]oxy-dimethylsilane.
| Compound Name | (4-butan-2-ylphenyl)-[butyl(dimethyl)silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 20652808 |
| Molecular Formula | C18H34OSi2 |
| Molecular Weight | 322.64 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (4-butan-2-ylphenyl)-[butyl(dimethyl)silyl]oxy-dimethylsilane |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)c1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C18H34OSi2/c1-8-10-15-20(4,5)19-21(6,7)18-13-11-17(12-14-18)16(3)9-2/h11-14,16H,8-10,15H2,1-7H3 |
| InChIKey | ILBJKSXMYZGHIU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.64 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|