About butan-2-ylbenzene;(4-butan-2-ylphenyl)-trimethylsilane
butan-2-ylbenzene;(4-butan-2-ylphenyl)-trimethylsilane (PubChem CID 161102550) has the molecular formula C23H36Si
and a molecular weight of 340.63 g/mol. Its IUPAC name is butan-2-ylbenzene;(4-butan-2-ylphenyl)-trimethylsilane.
Molecular Properties
| Compound Name | butan-2-ylbenzene;(4-butan-2-ylphenyl)-trimethylsilane |
| PubChem CID | 161102550 |
| Molecular Formula | C23H36Si |
| Molecular Weight | 340.63 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | butan-2-ylbenzene;(4-butan-2-ylphenyl)-trimethylsilane |
| SMILES | CCC(C)c1ccc([Si](C)(C)C)cc1.CCC(C)c1ccccc1 |
| InChI | InChI=1S/C13H22Si.C10H14/c1-6-11(2)12-7-9-13(10-8-12)14(3,4)5;1-3-9(2)10-7-5-4-6-8-10/h7-11H,6H2,1-5H3;4-9H,3H2,1-2H3 |
| InChIKey | UIPVWQBLZQLPAU-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.63 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ylbenzene;(4-butan-2-ylphenyl)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylbenzene;(4-butan-2-ylphenyl)-trimethylsilane?
The IUPAC name of butan-2-ylbenzene;(4-butan-2-ylphenyl)-trimethylsilane (CID 161102550) is butan-2-ylbenzene;(4-butan-2-ylphenyl)-trimethylsilane.
What is the SMILES notation for butan-2-ylbenzene;(4-butan-2-ylphenyl)-trimethylsilane?
The canonical SMILES for butan-2-ylbenzene;(4-butan-2-ylphenyl)-trimethylsilane is CCC(C)c1ccc([Si](C)(C)C)cc1.CCC(C)c1ccccc1.
What is the InChIKey of butan-2-ylbenzene;(4-butan-2-ylphenyl)-trimethylsilane?
The InChIKey is UIPVWQBLZQLPAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22Si.C10H14/c1-6-11(2)12-7-9-13(10-8-12)14(3,4)5;1-3-9(2)10-7-5-4-6-8-10/h7-11H,6H2,1-5H3;4-9H,3H2,1-2H3.
What are the key properties of butan-2-ylbenzene;(4-butan-2-ylphenyl)-trimethylsilane?
butan-2-ylbenzene;(4-butan-2-ylphenyl)-trimethylsilane has a molecular weight of 340.63 g/mol, XLogP of 6.95, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylbenzene;(4-butan-2-ylphenyl)-trimethylsilane is sourced from PubChem (CID 161102550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).