About azidoethane;butan-2-ylbenzene
azidoethane;butan-2-ylbenzene (PubChem CID 161488287) has the molecular formula C12H19N3
and a molecular weight of 205.31 g/mol. Its IUPAC name is azidoethane;butan-2-ylbenzene.
Molecular Properties
| Compound Name | azidoethane;butan-2-ylbenzene |
| PubChem CID | 161488287 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | azidoethane;butan-2-ylbenzene |
| SMILES | CCC(C)c1ccccc1.CCN=[N+]=[N-] |
| InChI | InChI=1S/C10H14.C2H5N3/c1-3-9(2)10-7-5-4-6-8-10;1-2-4-5-3/h4-9H,3H2,1-2H3;2H2,1H3 |
| InChIKey | WFGNGQPIDDQOJD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azidoethane;butan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azidoethane;butan-2-ylbenzene?
The IUPAC name of azidoethane;butan-2-ylbenzene (CID 161488287) is azidoethane;butan-2-ylbenzene.
What is the SMILES notation for azidoethane;butan-2-ylbenzene?
The canonical SMILES for azidoethane;butan-2-ylbenzene is CCC(C)c1ccccc1.CCN=[N+]=[N-].
What is the InChIKey of azidoethane;butan-2-ylbenzene?
The InChIKey is WFGNGQPIDDQOJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C2H5N3/c1-3-9(2)10-7-5-4-6-8-10;1-2-4-5-3/h4-9H,3H2,1-2H3;2H2,1H3.
What are the key properties of azidoethane;butan-2-ylbenzene?
azidoethane;butan-2-ylbenzene has a molecular weight of 205.31 g/mol, XLogP of 4.52, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azidoethane;butan-2-ylbenzene is sourced from PubChem (CID 161488287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).