About butan-2-ylbenzene;ethyl(trimethyl)azanium;chloride
butan-2-ylbenzene;ethyl(trimethyl)azanium;chloride (PubChem CID 169426198) has the molecular formula C15H28ClN
and a molecular weight of 257.85 g/mol. Its IUPAC name is butan-2-ylbenzene;ethyl(trimethyl)azanium;chloride.
Molecular Properties
| Compound Name | butan-2-ylbenzene;ethyl(trimethyl)azanium;chloride |
| PubChem CID | 169426198 |
| Molecular Formula | C15H28ClN |
| Molecular Weight | 257.85 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | butan-2-ylbenzene;ethyl(trimethyl)azanium;chloride |
| SMILES | CCC(C)c1ccccc1.CC[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C10H14.C5H14N.ClH/c1-3-9(2)10-7-5-4-6-8-10;1-5-6(2,3)4;/h4-9H,3H2,1-2H3;5H2,1-4H3;1H/q;+1;/p-1 |
| InChIKey | HPEAWGAKUAHRLD-UHFFFAOYSA-M |
| XLogP | 0.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.85 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ylbenzene;ethyl(trimethyl)azanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylbenzene;ethyl(trimethyl)azanium;chloride?
The IUPAC name of butan-2-ylbenzene;ethyl(trimethyl)azanium;chloride (CID 169426198) is butan-2-ylbenzene;ethyl(trimethyl)azanium;chloride.
What is the SMILES notation for butan-2-ylbenzene;ethyl(trimethyl)azanium;chloride?
The canonical SMILES for butan-2-ylbenzene;ethyl(trimethyl)azanium;chloride is CCC(C)c1ccccc1.CC[N+](C)(C)C.[Cl-].
What is the InChIKey of butan-2-ylbenzene;ethyl(trimethyl)azanium;chloride?
The InChIKey is HPEAWGAKUAHRLD-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H14.C5H14N.ClH/c1-3-9(2)10-7-5-4-6-8-10;1-5-6(2,3)4;/h4-9H,3H2,1-2H3;5H2,1-4H3;1H/q;+1;/p-1.
What are the key properties of butan-2-ylbenzene;ethyl(trimethyl)azanium;chloride?
butan-2-ylbenzene;ethyl(trimethyl)azanium;chloride has a molecular weight of 257.85 g/mol, XLogP of 0.92, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylbenzene;ethyl(trimethyl)azanium;chloride is sourced from PubChem (CID 169426198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).