C18H18S2 — CID 18994097
1-(4-butan-2-ylphenyl)-2-phenylethane-1,2-dithione (PubChem CID 18994097) has the molecular formula C18H18S2 and a molecular weight of 298.48 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)-2-phenylethane-1,2-dithione.
| Compound Name | 1-(4-butan-2-ylphenyl)-2-phenylethane-1,2-dithione |
|---|---|
| PubChem CID | 18994097 |
| Molecular Formula | C18H18S2 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)-2-phenylethane-1,2-dithione |
| SMILES | CCC(C)c1ccc(C(=S)C(=S)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H18S2/c1-3-13(2)14-9-11-16(12-10-14)18(20)17(19)15-7-5-4-6-8-15/h4-13H,3H2,1-2H3 |
| InChIKey | GROKCPGFOIHJGD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|