About 4-butan-2-ylaniline;ethane;1-methoxy-4-(1-phenylethenyl)benzene
4-butan-2-ylaniline;ethane;1-methoxy-4-(1-phenylethenyl)benzene (PubChem CID 144623859) has the molecular formula C27H35NO
and a molecular weight of 389.58 g/mol. Its IUPAC name is 4-butan-2-ylaniline;ethane;1-methoxy-4-(1-phenylethenyl)benzene.
Molecular Properties
| Compound Name | 4-butan-2-ylaniline;ethane;1-methoxy-4-(1-phenylethenyl)benzene |
| PubChem CID | 144623859 |
| Molecular Formula | C27H35NO |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | 4-butan-2-ylaniline;ethane;1-methoxy-4-(1-phenylethenyl)benzene |
| SMILES | C=C(c1ccccc1)c1ccc(OC)cc1.CC.CCC(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C15H14O.C10H15N.C2H6/c1-12(13-6-4-3-5-7-13)14-8-10-15(16-2)11-9-14;1-3-8(2)9-4-6-10(11)7-5-9;1-2/h3-11H,1H2,2H3;4-8H,3,11H2,1-2H3;1-2H3 |
| InChIKey | UWILEUNNDAWPGB-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-butan-2-ylaniline;ethane;1-methoxy-4-(1-phenylethenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-ylaniline;ethane;1-methoxy-4-(1-phenylethenyl)benzene?
The IUPAC name of 4-butan-2-ylaniline;ethane;1-methoxy-4-(1-phenylethenyl)benzene (CID 144623859) is 4-butan-2-ylaniline;ethane;1-methoxy-4-(1-phenylethenyl)benzene.
What is the SMILES notation for 4-butan-2-ylaniline;ethane;1-methoxy-4-(1-phenylethenyl)benzene?
The canonical SMILES for 4-butan-2-ylaniline;ethane;1-methoxy-4-(1-phenylethenyl)benzene is C=C(c1ccccc1)c1ccc(OC)cc1.CC.CCC(C)c1ccc(N)cc1.
What is the InChIKey of 4-butan-2-ylaniline;ethane;1-methoxy-4-(1-phenylethenyl)benzene?
The InChIKey is UWILEUNNDAWPGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O.C10H15N.C2H6/c1-12(13-6-4-3-5-7-13)14-8-10-15(16-2)11-9-14;1-3-8(2)9-4-6-10(11)7-5-9;1-2/h3-11H,1H2,2H3;4-8H,3,11H2,1-2H3;1-2H3.
What are the key properties of 4-butan-2-ylaniline;ethane;1-methoxy-4-(1-phenylethenyl)benzene?
4-butan-2-ylaniline;ethane;1-methoxy-4-(1-phenylethenyl)benzene has a molecular weight of 389.58 g/mol, XLogP of 7.57, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-ylaniline;ethane;1-methoxy-4-(1-phenylethenyl)benzene is sourced from PubChem (CID 144623859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).