C12H40O4Si7 — CID 123968259
bis(dimethylsilyl) bis[dimethylsilyl(dimethyl)silyl] silicate (PubChem CID 123968259) has the molecular formula C12H40O4Si7 and a molecular weight of 445.05 g/mol. Its IUPAC name is bis(dimethylsilyl) bis[dimethylsilyl(dimethyl)silyl] silicate.
| Compound Name | bis(dimethylsilyl) bis[dimethylsilyl(dimethyl)silyl] silicate |
|---|---|
| PubChem CID | 123968259 |
| Molecular Formula | C12H40O4Si7 |
| Molecular Weight | 445.05 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | bis(dimethylsilyl) bis[dimethylsilyl(dimethyl)silyl] silicate |
| SMILES | C[SiH](C)O[Si](O[SiH](C)C)(O[Si](C)(C)[SiH](C)C)O[Si](C)(C)[SiH](C)C |
| InChI | InChI=1S/C12H40O4Si7/c1-17(2)13-23(14-18(3)4,15-21(9,10)19(5)6)16-22(11,12)20(7)8/h17-20H,1-12H3 |
| InChIKey | HVQVLMCCLDJIIS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.05 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|