C11H21F9O5Si3 — CID 24957966
trimethyl [methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-trimethylsilyloxysilyl] silicate (PubChem CID 24957966) has the molecular formula C11H21F9O5Si3 and a molecular weight of 488.52 g/mol. Its IUPAC name is trimethyl [methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-trimethylsilyloxysilyl] silicate.
| Compound Name | trimethyl [methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-trimethylsilyloxysilyl] silicate |
|---|---|
| PubChem CID | 24957966 |
| Molecular Formula | C11H21F9O5Si3 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | trimethyl [methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-trimethylsilyloxysilyl] silicate |
| SMILES | CO[Si](OC)(OC)O[Si](C)(O[Si](C)(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H21F9O5Si3/c1-21-28(22-2,23-3)25-27(7,24-26(4,5)6)11(19,20)9(14,15)8(12,13)10(16,17)18/h1-7H3 |
| InChIKey | ZEQLEYXBJALSTL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|