C9H24Cl2O3Si4 — CID 15019993
chloro-[[[chloro(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-ethenyl-methylsilane (PubChem CID 15019993) has the molecular formula C9H24Cl2O3Si4 and a molecular weight of 363.54 g/mol. Its IUPAC name is chloro-[[[chloro(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-ethenyl-methylsilane.
| Compound Name | chloro-[[[chloro(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-ethenyl-methylsilane |
|---|---|
| PubChem CID | 15019993 |
| Molecular Formula | C9H24Cl2O3Si4 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | chloro-[[[chloro(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-ethenyl-methylsilane |
| SMILES | C=C[Si](C)(Cl)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)Cl |
| InChI | InChI=1S/C9H24Cl2O3Si4/c1-9-18(8,11)14-17(6,7)13-16(4,5)12-15(2,3)10/h9H,1H2,2-8H3 |
| InChIKey | HHUYUNIVLHLCRT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|