About [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane
[dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane (PubChem CID 23088318) has the molecular formula C10H25F3O2Si3
and a molecular weight of 318.56 g/mol. Its IUPAC name is [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane.
Molecular Properties
| Compound Name | [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane |
| PubChem CID | 23088318 |
| Molecular Formula | C10H25F3O2Si3 |
| Molecular Weight | 318.56 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane |
| SMILES | CC(F)C(F)(F)[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H25F3O2Si3/c1-9(11)10(12,13)17(5,6)15-18(7,8)14-16(2,3)4/h9H,1-8H3 |
| InChIKey | XULUADNQLORKAB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane?
The IUPAC name of [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane (CID 23088318) is [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane.
What is the SMILES notation for [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane?
The canonical SMILES for [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane is CC(F)C(F)(F)[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C.
What is the InChIKey of [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane?
The InChIKey is XULUADNQLORKAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H25F3O2Si3/c1-9(11)10(12,13)17(5,6)15-18(7,8)14-16(2,3)4/h9H,1-8H3.
What are the key properties of [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane?
[dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane has a molecular weight of 318.56 g/mol, XLogP of 4.29, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane is sourced from PubChem (CID 23088318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).