C10H25F3O2Si3 — CID 23088318
[dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane (PubChem CID 23088318) has the molecular formula C10H25F3O2Si3 and a molecular weight of 318.56 g/mol. Its IUPAC name is [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane.
| Compound Name | [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 23088318 |
| Molecular Formula | C10H25F3O2Si3 |
| Molecular Weight | 318.56 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | [dimethyl(1,1,2-trifluoropropyl)silyl]oxy-dimethyl-trimethylsilyloxysilane |
| SMILES | CC(F)C(F)(F)[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H25F3O2Si3/c1-9(11)10(12,13)17(5,6)15-18(7,8)14-16(2,3)4/h9H,1-8H3 |
| InChIKey | XULUADNQLORKAB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|