About [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane
[dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane (PubChem CID 89397515) has the molecular formula C11H32O2Si4
and a molecular weight of 308.72 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane.
Molecular Properties
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane |
| PubChem CID | 89397515 |
| Molecular Formula | C11H32O2Si4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane |
| SMILES | C[Si](C)(C)O[Si](C)(C)C[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H32O2Si4/c1-14(2,3)12-16(7,8)11-17(9,10)13-15(4,5)6/h11H2,1-10H3 |
| InChIKey | JCKZGQIIXGIUSE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane?
The IUPAC name of [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane (CID 89397515) is [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane.
What is the SMILES notation for [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane?
The canonical SMILES for [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane is C[Si](C)(C)O[Si](C)(C)C[Si](C)(C)O[Si](C)(C)C.
What is the InChIKey of [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane?
The InChIKey is JCKZGQIIXGIUSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H32O2Si4/c1-14(2,3)12-16(7,8)11-17(9,10)13-15(4,5)6/h11H2,1-10H3.
What are the key properties of [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane?
[dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane has a molecular weight of 308.72 g/mol, XLogP of 4.64, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane is sourced from PubChem (CID 89397515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).