C11H32O2Si4 — CID 89397515
[dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane (PubChem CID 89397515) has the molecular formula C11H32O2Si4 and a molecular weight of 308.72 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 89397515 |
| Molecular Formula | C11H32O2Si4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]methyl-dimethyl-trimethylsilyloxysilane |
| SMILES | C[Si](C)(C)O[Si](C)(C)C[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H32O2Si4/c1-14(2,3)12-16(7,8)11-17(9,10)13-15(4,5)6/h11H2,1-10H3 |
| InChIKey | JCKZGQIIXGIUSE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|