C15H46N2OSi4 — CID 158267092
N'-[[[dimethyl(trimethylsilyloxy)silyl]methyl-methyl-(trimethylsilylmethyl)silyl]methyl]methanediamine;methane (PubChem CID 158267092) has the molecular formula C15H46N2OSi4 and a molecular weight of 382.89 g/mol. Its IUPAC name is N'-[[[dimethyl(trimethylsilyloxy)silyl]methyl-methyl-(trimethylsilylmethyl)silyl]methyl]methanediamine;methane.
| Compound Name | N'-[[[dimethyl(trimethylsilyloxy)silyl]methyl-methyl-(trimethylsilylmethyl)silyl]methyl]methanediamine;methane |
|---|---|
| PubChem CID | 158267092 |
| Molecular Formula | C15H46N2OSi4 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | N'-[[[dimethyl(trimethylsilyloxy)silyl]methyl-methyl-(trimethylsilylmethyl)silyl]methyl]methanediamine;methane |
| SMILES | C.C.C[Si](C)(C)C[Si](C)(CNCN)C[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H38N2OSi4.2CH4/c1-17(2,3)12-20(9,11-15-10-14)13-19(7,8)16-18(4,5)6;;/h15H,10-14H2,1-9H3;2*1H4 |
| InChIKey | GIOUSPZZGREDJG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|