C11H30N2OSi2 — CID 175147128
N-[[dimethyl(trimethylsilyloxy)silyl]methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 175147128) has the molecular formula C11H30N2OSi2 and a molecular weight of 262.55 g/mol. Its IUPAC name is N-[[dimethyl(trimethylsilyloxy)silyl]methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[[dimethyl(trimethylsilyloxy)silyl]methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 175147128 |
| Molecular Formula | C11H30N2OSi2 |
| Molecular Weight | 262.55 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | N-[[dimethyl(trimethylsilyloxy)silyl]methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H30N2OSi2/c1-13(2)10-8-9-12-11-16(6,7)14-15(3,4)5/h12H,8-11H2,1-7H3 |
| InChIKey | GUAAOPXBRUGXKB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|