C14H42O6Si7 — CID 172634816
CID 172634816 (PubChem CID 172634816) has the molecular formula C14H42O6Si7 and a molecular weight of 503.09 g/mol.
| Compound Name | CID 172634816 |
|---|---|
| PubChem CID | 172634816 |
| Molecular Formula | C14H42O6Si7 |
| Molecular Weight | 503.09 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)O[Si](C)(O[Si]O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H42O6Si7/c1-22(2,3)17-26(13,18-23(4,5)6)15-21-16-27(14,19-24(7,8)9)20-25(10,11)12/h1-14H3 |
| InChIKey | OPPBCHNZPCTINF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.09 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|